C42H36O10 — CID 132991465
[(2R,3S,4R,5R)-3,4,5-tribenzoyloxy-2-(2-phenylethoxy)oxan-2-yl]methyl benzoate (PubChem CID 132991465) has the molecular formula C42H36O10 and a molecular weight of 700.74 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4,5-tribenzoyloxy-2-(2-phenylethoxy)oxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4R,5R)-3,4,5-tribenzoyloxy-2-(2-phenylethoxy)oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 132991465 |
| Molecular Formula | C42H36O10 |
| Molecular Weight | 700.74 g/mol |
| Exact Mass | 700.23 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4,5-tribenzoyloxy-2-(2-phenylethoxy)oxan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@@]1(OCCc2ccccc2)OC[C@@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H36O10/c43-38(31-18-8-2-9-19-31)47-29-42(48-27-26-30-16-6-1-7-17-30)37(52-41(46)34-24-14-5-15-25-34)36(51-40(45)33-22-12-4-13-23-33)35(28-49-42)50-39(44)32-20-10-3-11-21-32/h1-25,35-37H,26-29H2/t35-,36-,37+,42-/m1/s1 |
| InChIKey | HGGQWIRNPAXTMK-XFDNUTRLSA-N |
| XLogP | 6.51 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.74 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|