C36H31IO10 — CID 18632083
[(3S,4R,5R,6S)-3,4,5-tribenzoyloxy-6-(iodomethyl)-2-methoxyoxan-2-yl]methyl benzoate (PubChem CID 18632083) has the molecular formula C36H31IO10 and a molecular weight of 750.54 g/mol. Its IUPAC name is [(3S,4R,5R,6S)-3,4,5-tribenzoyloxy-6-(iodomethyl)-2-methoxyoxan-2-yl]methyl benzoate.
| Compound Name | [(3S,4R,5R,6S)-3,4,5-tribenzoyloxy-6-(iodomethyl)-2-methoxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 18632083 |
| Molecular Formula | C36H31IO10 |
| Molecular Weight | 750.54 g/mol |
| Exact Mass | 750.10 |
| IUPAC Name | [(3S,4R,5R,6S)-3,4,5-tribenzoyloxy-6-(iodomethyl)-2-methoxyoxan-2-yl]methyl benzoate |
| SMILES | COC1(COC(=O)c2ccccc2)O[C@H](CI)[C@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C36H31IO10/c1-42-36(23-43-32(38)24-14-6-2-7-15-24)31(46-35(41)27-20-12-5-13-21-27)30(45-34(40)26-18-10-4-11-19-26)29(28(22-37)47-36)44-33(39)25-16-8-3-9-17-25/h2-21,28-31H,22-23H2,1H3/t28-,29+,30-,31+,36?/m1/s1 |
| InChIKey | YHVBDZQHHBJZKQ-NFNAJPNSSA-N |
| XLogP | 5.70 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|