C29H26O8 — CID 10815303
[(2R,3S,4R)-3,4-dibenzoyloxy-2-ethenyl-5-methoxyoxolan-2-yl]methyl benzoate (PubChem CID 10815303) has the molecular formula C29H26O8 and a molecular weight of 502.52 g/mol. Its IUPAC name is [(2R,3S,4R)-3,4-dibenzoyloxy-2-ethenyl-5-methoxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4R)-3,4-dibenzoyloxy-2-ethenyl-5-methoxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 10815303 |
| Molecular Formula | C29H26O8 |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | [(2R,3S,4R)-3,4-dibenzoyloxy-2-ethenyl-5-methoxyoxolan-2-yl]methyl benzoate |
| SMILES | C=C[C@]1(COC(=O)c2ccccc2)OC(OC)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H26O8/c1-3-29(19-34-25(30)20-13-7-4-8-14-20)24(36-27(32)22-17-11-6-12-18-22)23(28(33-2)37-29)35-26(31)21-15-9-5-10-16-21/h3-18,23-24,28H,1,19H2,2H3/t23-,24+,28?,29-/m1/s1 |
| InChIKey | KGSJXZGPHKZHAE-LADWPMNLSA-N |
| XLogP | 4.22 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|