C22H20O6 — CID 14186968
(3-benzoyloxy-2-methoxy-7-oxabicyclo[4.1.0]hept-4-en-1-yl)methyl benzoate (PubChem CID 14186968) has the molecular formula C22H20O6 and a molecular weight of 380.40 g/mol. Its IUPAC name is (3-benzoyloxy-2-methoxy-7-oxabicyclo[4.1.0]hept-4-en-1-yl)methyl benzoate.
| Compound Name | (3-benzoyloxy-2-methoxy-7-oxabicyclo[4.1.0]hept-4-en-1-yl)methyl benzoate |
|---|---|
| PubChem CID | 14186968 |
| Molecular Formula | C22H20O6 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (3-benzoyloxy-2-methoxy-7-oxabicyclo[4.1.0]hept-4-en-1-yl)methyl benzoate |
| SMILES | COC1C(OC(=O)c2ccccc2)C=CC2OC21COC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H20O6/c1-25-19-17(27-21(24)16-10-6-3-7-11-16)12-13-18-22(19,28-18)14-26-20(23)15-8-4-2-5-9-15/h2-13,17-19H,14H2,1H3 |
| InChIKey | KLNVBHGVSMXWOX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|