C20H22O9 — CID 163056874
[(1S,2R,5S,6R)-2,5,6-triacetyloxy-1-hydroxycyclohex-3-en-1-yl]methyl benzoate (PubChem CID 163056874) has the molecular formula C20H22O9 and a molecular weight of 406.39 g/mol. Its IUPAC name is [(1S,2R,5S,6R)-2,5,6-triacetyloxy-1-hydroxycyclohex-3-en-1-yl]methyl benzoate.
| Compound Name | [(1S,2R,5S,6R)-2,5,6-triacetyloxy-1-hydroxycyclohex-3-en-1-yl]methyl benzoate |
|---|---|
| PubChem CID | 163056874 |
| Molecular Formula | C20H22O9 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | [(1S,2R,5S,6R)-2,5,6-triacetyloxy-1-hydroxycyclohex-3-en-1-yl]methyl benzoate |
| SMILES | CC(=O)O[C@H]1C=C[C@@H](OC(C)=O)[C@@](O)(COC(=O)c2ccccc2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H22O9/c1-12(21)27-16-9-10-17(28-13(2)22)20(25,18(16)29-14(3)23)11-26-19(24)15-7-5-4-6-8-15/h4-10,16-18,25H,11H2,1-3H3/t16-,17+,18+,20-/m0/s1 |
| InChIKey | BJASBPAUIPMSBA-XFKSJGNHSA-N |
| XLogP | 0.94 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|