C21H18O6 — CID 51423780
[(1R,2S,3S,6S)-3-benzoyloxy-2-hydroxy-7-oxabicyclo[4.1.0]hept-4-en-1-yl]methyl benzoate (PubChem CID 51423780) has the molecular formula C21H18O6 and a molecular weight of 366.37 g/mol. Its IUPAC name is [(1R,2S,3S,6S)-3-benzoyloxy-2-hydroxy-7-oxabicyclo[4.1.0]hept-4-en-1-yl]methyl benzoate.
| Compound Name | [(1R,2S,3S,6S)-3-benzoyloxy-2-hydroxy-7-oxabicyclo[4.1.0]hept-4-en-1-yl]methyl benzoate |
|---|---|
| PubChem CID | 51423780 |
| Molecular Formula | C21H18O6 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | [(1R,2S,3S,6S)-3-benzoyloxy-2-hydroxy-7-oxabicyclo[4.1.0]hept-4-en-1-yl]methyl benzoate |
| SMILES | O=C(OC[C@]12O[C@H]1C=C[C@H](OC(=O)c1ccccc1)[C@@H]2O)c1ccccc1 |
| InChI | InChI=1S/C21H18O6/c22-18-16(26-20(24)15-9-5-2-6-10-15)11-12-17-21(18,27-17)13-25-19(23)14-7-3-1-4-8-14/h1-12,16-18,22H,13H2/t16-,17-,18-,21-/m0/s1 |
| InChIKey | BHNSEWKVMCNSGO-NTLWEQJWSA-N |
| XLogP | 2.14 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|