C27H22O7 — CID 10939443
[(2R)-2-benzoyloxy-2-[(2S,3R)-3-benzoyloxy-2,3-dihydrofuran-2-yl]ethyl] benzoate (PubChem CID 10939443) has the molecular formula C27H22O7 and a molecular weight of 458.47 g/mol. Its IUPAC name is [(2R)-2-benzoyloxy-2-[(2S,3R)-3-benzoyloxy-2,3-dihydrofuran-2-yl]ethyl] benzoate.
| Compound Name | [(2R)-2-benzoyloxy-2-[(2S,3R)-3-benzoyloxy-2,3-dihydrofuran-2-yl]ethyl] benzoate |
|---|---|
| PubChem CID | 10939443 |
| Molecular Formula | C27H22O7 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | [(2R)-2-benzoyloxy-2-[(2S,3R)-3-benzoyloxy-2,3-dihydrofuran-2-yl]ethyl] benzoate |
| SMILES | O=C(OC[C@@H](OC(=O)c1ccccc1)[C@H]1OC=C[C@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H22O7/c28-25(19-10-4-1-5-11-19)32-18-23(34-27(30)21-14-8-3-9-15-21)24-22(16-17-31-24)33-26(29)20-12-6-2-7-13-20/h1-17,22-24H,18H2/t22-,23-,24+/m1/s1 |
| InChIKey | UURXHFFLSSVUPZ-SMIHKQSGSA-N |
| XLogP | 4.21 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|