C41H32NO13- — CID 163141966
[3,4-dibenzoyloxy-5-(1,2-dibenzoyloxyethyl)oxolan-2-yl] 4-[hydroxy(oxido)amino]benzoate (PubChem CID 163141966) has the molecular formula C41H32NO13- and a molecular weight of 746.70 g/mol. Its IUPAC name is [3,4-dibenzoyloxy-5-(1,2-dibenzoyloxyethyl)oxolan-2-yl] 4-[hydroxy(oxido)amino]benzoate.
| Compound Name | [3,4-dibenzoyloxy-5-(1,2-dibenzoyloxyethyl)oxolan-2-yl] 4-[hydroxy(oxido)amino]benzoate |
|---|---|
| PubChem CID | 163141966 |
| Molecular Formula | C41H32NO13- |
| Molecular Weight | 746.70 g/mol |
| Exact Mass | 746.19 |
| IUPAC Name | [3,4-dibenzoyloxy-5-(1,2-dibenzoyloxyethyl)oxolan-2-yl] 4-[hydroxy(oxido)amino]benzoate |
| SMILES | O=C(OCC(OC(=O)c1ccccc1)C1OC(OC(=O)c2ccc(N([O-])O)cc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H32NO13/c43-36(26-13-5-1-6-14-26)50-25-32(51-37(44)27-15-7-2-8-16-27)33-34(52-38(45)28-17-9-3-10-18-28)35(53-39(46)29-19-11-4-12-20-29)41(54-33)55-40(47)30-21-23-31(24-22-30)42(48)49/h1-24,32-35,41,48H,25H2/q-1 |
| InChIKey | YUZSOGMOJUMXHF-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 187.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.70 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|