C18H20O8 — CID 102450482
[(1R,4S,5R,6R)-4-acetyloxy-6-(acetyloxymethyl)-5,6-dihydroxycyclohex-2-en-1-yl] benzoate (PubChem CID 102450482) has the molecular formula C18H20O8 and a molecular weight of 364.35 g/mol. Its IUPAC name is [(1R,4S,5R,6R)-4-acetyloxy-6-(acetyloxymethyl)-5,6-dihydroxycyclohex-2-en-1-yl] benzoate.
| Compound Name | [(1R,4S,5R,6R)-4-acetyloxy-6-(acetyloxymethyl)-5,6-dihydroxycyclohex-2-en-1-yl] benzoate |
|---|---|
| PubChem CID | 102450482 |
| Molecular Formula | C18H20O8 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | [(1R,4S,5R,6R)-4-acetyloxy-6-(acetyloxymethyl)-5,6-dihydroxycyclohex-2-en-1-yl] benzoate |
| SMILES | CC(=O)OC[C@@]1(O)[C@H](O)[C@@H](OC(C)=O)C=C[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H20O8/c1-11(19)24-10-18(23)15(9-8-14(16(18)21)25-12(2)20)26-17(22)13-6-4-3-5-7-13/h3-9,14-16,21,23H,10H2,1-2H3/t14-,15+,16+,18-/m0/s1 |
| InChIKey | MMCPYZQGIAIGLY-LHHMISFZSA-N |
| XLogP | 0.37 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|