C21H20O8 — CID 16741796
[(1S,2S,3S,4S,5R,6R)-4-benzoyloxy-2,3,5-trihydroxy-7-oxabicyclo[4.1.0]heptan-1-yl]methyl benzoate (PubChem CID 16741796) has the molecular formula C21H20O8 and a molecular weight of 400.38 g/mol. Its IUPAC name is [(1S,2S,3S,4S,5R,6R)-4-benzoyloxy-2,3,5-trihydroxy-7-oxabicyclo[4.1.0]heptan-1-yl]methyl benzoate.
| Compound Name | [(1S,2S,3S,4S,5R,6R)-4-benzoyloxy-2,3,5-trihydroxy-7-oxabicyclo[4.1.0]heptan-1-yl]methyl benzoate |
|---|---|
| PubChem CID | 16741796 |
| Molecular Formula | C21H20O8 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | [(1S,2S,3S,4S,5R,6R)-4-benzoyloxy-2,3,5-trihydroxy-7-oxabicyclo[4.1.0]heptan-1-yl]methyl benzoate |
| SMILES | O=C(OC[C@@]12O[C@@H]1[C@H](O)[C@@H](OC(=O)c1ccccc1)[C@@H](O)[C@@H]2O)c1ccccc1 |
| InChI | InChI=1S/C21H20O8/c22-14-16(28-20(26)13-9-5-2-6-10-13)15(23)18-21(29-18,17(14)24)11-27-19(25)12-7-3-1-4-8-12/h1-10,14-18,22-24H,11H2/t14-,15-,16+,17+,18-,21+/m1/s1 |
| InChIKey | MJGAWEWLKZQGDP-WPJCTDPYSA-N |
| XLogP | 0.30 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|