C35H26O9 — CID 101165037
[(1R,5S,6R)-1,5,6-tribenzoyloxy-2-oxocyclohex-3-en-1-yl]methyl benzoate (PubChem CID 101165037) has the molecular formula C35H26O9 and a molecular weight of 590.58 g/mol. Its IUPAC name is [(1R,5S,6R)-1,5,6-tribenzoyloxy-2-oxocyclohex-3-en-1-yl]methyl benzoate.
| Compound Name | [(1R,5S,6R)-1,5,6-tribenzoyloxy-2-oxocyclohex-3-en-1-yl]methyl benzoate |
|---|---|
| PubChem CID | 101165037 |
| Molecular Formula | C35H26O9 |
| Molecular Weight | 590.58 g/mol |
| Exact Mass | 590.16 |
| IUPAC Name | [(1R,5S,6R)-1,5,6-tribenzoyloxy-2-oxocyclohex-3-en-1-yl]methyl benzoate |
| SMILES | O=C(OC[C@]1(OC(=O)c2ccccc2)C(=O)C=CC(OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H26O9/c36-29-22-21-28(42-32(38)25-15-7-2-8-16-25)30(43-33(39)26-17-9-3-10-18-26)35(29,44-34(40)27-19-11-4-12-20-27)23-41-31(37)24-13-5-1-6-14-24/h1-22,28,30H,23H2/t28?,30-,35+/m1/s1 |
| InChIKey | PBMZPHGICLWIOQ-LVTUGFOTSA-N |
| XLogP | 5.03 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|