C16H16O7 — CID 11823358
[(1S,4S,7S,8S)-7-acetyloxy-8-hydroxy-2,3-dioxabicyclo[2.2.2]oct-5-en-1-yl]methyl benzoate (PubChem CID 11823358) has the molecular formula C16H16O7 and a molecular weight of 320.30 g/mol. Its IUPAC name is [(1S,4S,7S,8S)-7-acetyloxy-8-hydroxy-2,3-dioxabicyclo[2.2.2]oct-5-en-1-yl]methyl benzoate.
| Compound Name | [(1S,4S,7S,8S)-7-acetyloxy-8-hydroxy-2,3-dioxabicyclo[2.2.2]oct-5-en-1-yl]methyl benzoate |
|---|---|
| PubChem CID | 11823358 |
| Molecular Formula | C16H16O7 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | [(1S,4S,7S,8S)-7-acetyloxy-8-hydroxy-2,3-dioxabicyclo[2.2.2]oct-5-en-1-yl]methyl benzoate |
| SMILES | CC(=O)O[C@H]1[C@H](O)[C@@H]2C=C[C@@]1(COC(=O)c1ccccc1)OO2 |
| InChI | InChI=1S/C16H16O7/c1-10(17)21-14-13(18)12-7-8-16(14,23-22-12)9-20-15(19)11-5-3-2-4-6-11/h2-8,12-14,18H,9H2,1H3/t12-,13+,14-,16-/m0/s1 |
| InChIKey | ZTWFDZYHMHKKOX-FQLMCAECSA-N |
| XLogP | 0.77 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|