C28H24O7 — CID 10672110
[(1S,2R,4aR,9aR)-2-benzoyloxy-1,7-dihydroxy-1,2,9,9a-tetrahydroxanthen-4a-yl]methyl benzoate (PubChem CID 10672110) has the molecular formula C28H24O7 and a molecular weight of 472.49 g/mol. Its IUPAC name is [(1S,2R,4aR,9aR)-2-benzoyloxy-1,7-dihydroxy-1,2,9,9a-tetrahydroxanthen-4a-yl]methyl benzoate.
| Compound Name | [(1S,2R,4aR,9aR)-2-benzoyloxy-1,7-dihydroxy-1,2,9,9a-tetrahydroxanthen-4a-yl]methyl benzoate |
|---|---|
| PubChem CID | 10672110 |
| Molecular Formula | C28H24O7 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | [(1S,2R,4aR,9aR)-2-benzoyloxy-1,7-dihydroxy-1,2,9,9a-tetrahydroxanthen-4a-yl]methyl benzoate |
| SMILES | O=C(OC[C@@]12C=C[C@@H](OC(=O)c3ccccc3)[C@@H](O)[C@H]1Cc1cc(O)ccc1O2)c1ccccc1 |
| InChI | InChI=1S/C28H24O7/c29-21-11-12-23-20(15-21)16-22-25(30)24(34-27(32)19-9-5-2-6-10-19)13-14-28(22,35-23)17-33-26(31)18-7-3-1-4-8-18/h1-15,22,24-25,29-30H,16-17H2/t22-,24-,25+,28+/m1/s1 |
| InChIKey | HWPZTWAKYXOVBI-HTFRYZPTSA-N |
| XLogP | 3.70 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|