C22H24O10 — CID 122396073
[2-[(2S,3R,4S,5S,6R)-3-acetyloxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-hydroxyphenyl]methyl benzoate (PubChem CID 122396073) has the molecular formula C22H24O10 and a molecular weight of 448.42 g/mol. Its IUPAC name is [2-[(2S,3R,4S,5S,6R)-3-acetyloxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-hydroxyphenyl]methyl benzoate.
| Compound Name | [2-[(2S,3R,4S,5S,6R)-3-acetyloxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-hydroxyphenyl]methyl benzoate |
|---|---|
| PubChem CID | 122396073 |
| Molecular Formula | C22H24O10 |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | [2-[(2S,3R,4S,5S,6R)-3-acetyloxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-hydroxyphenyl]methyl benzoate |
| SMILES | CC(=O)O[C@H]1[C@H](Oc2ccc(O)cc2COC(=O)c2ccccc2)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H24O10/c1-12(24)30-20-19(27)18(26)17(10-23)32-22(20)31-16-8-7-15(25)9-14(16)11-29-21(28)13-5-3-2-4-6-13/h2-9,17-20,22-23,25-27H,10-11H2,1H3/t17-,18-,19+,20-,22-/m1/s1 |
| InChIKey | OLFQKMRQDLVXPF-OUUKCGNVSA-N |
| XLogP | 0.50 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |