C27H32O14 — CID 98598119
[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-[4-hydroxy-2-[[(1R,2S,3S,6R)-1,2,3,6-tetrahydroxycyclohexanecarbonyl]oxymethyl]phenoxy]oxan-2-yl]methyl benzoate (PubChem CID 98598119) has the molecular formula C27H32O14 and a molecular weight of 580.54 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-[4-hydroxy-2-[[(1R,2S,3S,6R)-1,2,3,6-tetrahydroxycyclohexanecarbonyl]oxymethyl]phenoxy]oxan-2-yl]methyl benzoate.
| Compound Name | [(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-[4-hydroxy-2-[[(1R,2S,3S,6R)-1,2,3,6-tetrahydroxycyclohexanecarbonyl]oxymethyl]phenoxy]oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 98598119 |
| Molecular Formula | C27H32O14 |
| Molecular Weight | 580.54 g/mol |
| Exact Mass | 580.18 |
| IUPAC Name | [(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-[4-hydroxy-2-[[(1R,2S,3S,6R)-1,2,3,6-tetrahydroxycyclohexanecarbonyl]oxymethyl]phenoxy]oxan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@@H]1O[C@@H](Oc2ccc(O)cc2COC(=O)[C@@]2(O)[C@H](O)CC[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C27H32O14/c28-15-6-8-17(14(10-15)11-39-26(36)27(37)19(30)9-7-16(29)23(27)34)40-25-22(33)21(32)20(31)18(41-25)12-38-24(35)13-4-2-1-3-5-13/h1-6,8,10,16,18-23,25,28-34,37H,7,9,11-12H2/t16-,18-,19+,20-,21-,22-,23-,25+,27+/m0/s1 |
| InChIKey | JMCVYQUHLKARLD-QLMGZSFISA-N |
| XLogP | -1.91 |
| TPSA | 232.90 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.54 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |