C20H22O9 — CID 101244598
[5-hydroxy-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl benzoate (PubChem CID 101244598) has the molecular formula C20H22O9 and a molecular weight of 406.39 g/mol. Its IUPAC name is [5-hydroxy-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl benzoate.
| Compound Name | [5-hydroxy-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl benzoate |
|---|---|
| PubChem CID | 101244598 |
| Molecular Formula | C20H22O9 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | [5-hydroxy-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl benzoate |
| SMILES | O=C(OCc1cc(O)ccc1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C20H22O9/c21-9-15-16(23)17(24)18(25)20(29-15)28-14-7-6-13(22)8-12(14)10-27-19(26)11-4-2-1-3-5-11/h1-8,15-18,20-25H,9-10H2/t15-,16-,17+,18-,20+/m1/s1 |
| InChIKey | UQCOPGRRWQCCFR-NUABRCLCSA-N |
| XLogP | -0.07 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |