C18H26O9 — CID 162855179
butyl 2-[5-hydroxy-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetate (PubChem CID 162855179) has the molecular formula C18H26O9 and a molecular weight of 386.40 g/mol. Its IUPAC name is butyl 2-[5-hydroxy-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetate.
| Compound Name | butyl 2-[5-hydroxy-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetate |
|---|---|
| PubChem CID | 162855179 |
| Molecular Formula | C18H26O9 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | butyl 2-[5-hydroxy-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetate |
| SMILES | CCCCOC(=O)Cc1cc(O)ccc1OC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C18H26O9/c1-2-3-6-25-14(21)8-10-7-11(20)4-5-12(10)26-18-17(24)16(23)15(22)13(9-19)27-18/h4-5,7,13,15-20,22-24H,2-3,6,8-9H2,1H3 |
| InChIKey | WYXBAFLYAXPEAS-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|