C24H38O9 — CID 149251651
[3-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl decanoate (PubChem CID 149251651) has the molecular formula C24H38O9 and a molecular weight of 470.56 g/mol. Its IUPAC name is [3-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl decanoate.
| Compound Name | [3-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl decanoate |
|---|---|
| PubChem CID | 149251651 |
| Molecular Formula | C24H38O9 |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | [3-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl decanoate |
| SMILES | CCCCCCCCCC(=O)OCc1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(OC)c1 |
| InChI | InChI=1S/C24H38O9/c1-3-4-5-6-7-8-9-10-20(26)31-15-16-11-12-17(18(13-16)30-2)32-24-23(29)22(28)21(27)19(14-25)33-24/h11-13,19,21-25,27-29H,3-10,14-15H2,1-2H3/t19-,21-,22+,23-,24-/m1/s1 |
| InChIKey | QCRZBZUQMSECHX-PFKOEMKTSA-N |
| XLogP | 2.06 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|