C23H37NO8 — CID 67847950
N-[[3-methoxy-4-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl]nonanamide (PubChem CID 67847950) has the molecular formula C23H37NO8 and a molecular weight of 455.55 g/mol. Its IUPAC name is N-[[3-methoxy-4-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl]nonanamide.
| Compound Name | N-[[3-methoxy-4-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl]nonanamide |
|---|---|
| PubChem CID | 67847950 |
| Molecular Formula | C23H37NO8 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | N-[[3-methoxy-4-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl]nonanamide |
| SMILES | CCCCCCCCC(=O)NCc1ccc(OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(OC)c1 |
| InChI | InChI=1S/C23H37NO8/c1-3-4-5-6-7-8-9-19(26)24-13-15-10-11-16(17(12-15)30-2)31-23-22(29)21(28)20(27)18(14-25)32-23/h10-12,18,20-23,25,27-29H,3-9,13-14H2,1-2H3,(H,24,26)/t18-,20-,21+,22-,23?/m1/s1 |
| InChIKey | JDOMMYNAVUPDNG-HZKCKKNMSA-N |
| XLogP | 1.24 |
| TPSA | 137.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|