C24H32O8 — CID 14828967
(12-acetyloxy-4,5,8-trihydroxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl) benzoate (PubChem CID 14828967) has the molecular formula C24H32O8 and a molecular weight of 448.51 g/mol. Its IUPAC name is (12-acetyloxy-4,5,8-trihydroxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl) benzoate.
| Compound Name | (12-acetyloxy-4,5,8-trihydroxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl) benzoate |
|---|---|
| PubChem CID | 14828967 |
| Molecular Formula | C24H32O8 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | (12-acetyloxy-4,5,8-trihydroxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl) benzoate |
| SMILES | CC(=O)OC1C2C(O)C(OC(=O)c3ccccc3)C3(C)C(O)C(O)CC(C)C13OC2(C)C |
| InChI | InChI=1S/C24H32O8/c1-12-11-15(26)18(28)23(5)20(31-21(29)14-9-7-6-8-10-14)17(27)16-19(30-13(2)25)24(12,23)32-22(16,3)4/h6-10,12,15-20,26-28H,11H2,1-5H3 |
| InChIKey | GXEBTQQOZPQEKD-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |