C30H38O12 — CID 162885790
[(1R,2R,4R,5S,6S,7R,8R,9S,12S)-4,5,8,12-tetraacetyloxy-6-(hydroxymethyl)-2,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] benzoate (PubChem CID 162885790) has the molecular formula C30H38O12 and a molecular weight of 590.62 g/mol. Its IUPAC name is [(1R,2R,4R,5S,6S,7R,8R,9S,12S)-4,5,8,12-tetraacetyloxy-6-(hydroxymethyl)-2,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] benzoate.
| Compound Name | [(1R,2R,4R,5S,6S,7R,8R,9S,12S)-4,5,8,12-tetraacetyloxy-6-(hydroxymethyl)-2,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] benzoate |
|---|---|
| PubChem CID | 162885790 |
| Molecular Formula | C30H38O12 |
| Molecular Weight | 590.62 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | [(1R,2R,4R,5S,6S,7R,8R,9S,12S)-4,5,8,12-tetraacetyloxy-6-(hydroxymethyl)-2,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] benzoate |
| SMILES | CC(=O)O[C@@H]1[C@H]2[C@H](OC(C)=O)[C@@]3(OC2(C)C)[C@H](C)C[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@]3(CO)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H38O12/c1-15-13-21(37-16(2)32)24(39-18(4)34)29(14-31)26(41-27(36)20-11-9-8-10-12-20)23(38-17(3)33)22-25(40-19(5)35)30(15,29)42-28(22,6)7/h8-12,15,21-26,31H,13-14H2,1-7H3/t15-,21-,22+,23-,24-,25+,26+,29+,30+/m1/s1 |
| InChIKey | WBPCDFQDJNMSIL-PLWMUYQMSA-N |
| XLogP | 2.13 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.62 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|