C22H24O8S — CID 11070361
[(5S,7R,8R,9S)-8,9-bis(phenylmethoxy)-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] methanesulfonate (PubChem CID 11070361) has the molecular formula C22H24O8S and a molecular weight of 448.49 g/mol. Its IUPAC name is [(5S,7R,8R,9S)-8,9-bis(phenylmethoxy)-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] methanesulfonate.
| Compound Name | [(5S,7R,8R,9S)-8,9-bis(phenylmethoxy)-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] methanesulfonate |
|---|---|
| PubChem CID | 11070361 |
| Molecular Formula | C22H24O8S |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | [(5S,7R,8R,9S)-8,9-bis(phenylmethoxy)-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-yl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1[C@H]2OC3OC([C@@H](OCc4ccccc4)[C@H]1O3)[C@@H]2OCc1ccccc1 |
| InChI | InChI=1S/C22H24O8S/c1-31(23,24)30-21-19-16(25-12-14-8-4-2-5-9-14)18-17(20(21)29-22(27-18)28-19)26-13-15-10-6-3-7-11-15/h2-11,16-22H,12-13H2,1H3/t16-,17+,18?,19-,20+,21?,22? |
| InChIKey | VQQSJLMGPRGANH-IIYYHEFNSA-N |
| XLogP | 1.98 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|