C35H36O8S — CID 135042605
[(5R)-2-hydroxy-3,4,5,6-tetrakis(phenylmethoxy)cyclohex-2-en-1-yl] methanesulfonate (PubChem CID 135042605) has the molecular formula C35H36O8S and a molecular weight of 616.73 g/mol. Its IUPAC name is [(5R)-2-hydroxy-3,4,5,6-tetrakis(phenylmethoxy)cyclohex-2-en-1-yl] methanesulfonate.
| Compound Name | [(5R)-2-hydroxy-3,4,5,6-tetrakis(phenylmethoxy)cyclohex-2-en-1-yl] methanesulfonate |
|---|---|
| PubChem CID | 135042605 |
| Molecular Formula | C35H36O8S |
| Molecular Weight | 616.73 g/mol |
| Exact Mass | 616.21 |
| IUPAC Name | [(5R)-2-hydroxy-3,4,5,6-tetrakis(phenylmethoxy)cyclohex-2-en-1-yl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1C(O)=C(OCc2ccccc2)C(OCc2ccccc2)[C@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C35H36O8S/c1-44(37,38)43-32-30(36)31(39-22-26-14-6-2-7-15-26)33(40-23-27-16-8-3-9-17-27)35(42-25-29-20-12-5-13-21-29)34(32)41-24-28-18-10-4-11-19-28/h2-21,32-36H,22-25H2,1H3/t32?,33?,34?,35-/m0/s1 |
| InChIKey | MRZOUUAGGPDEGR-KHLWYWJLSA-N |
| XLogP | 6.09 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.73 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|