C35H34O5 — CID 91134295
(5R,6R)-4,5,6-tris(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohex-3-en-1-one (PubChem CID 91134295) has the molecular formula C35H34O5 and a molecular weight of 534.65 g/mol. Its IUPAC name is (5R,6R)-4,5,6-tris(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohex-3-en-1-one.
| Compound Name | (5R,6R)-4,5,6-tris(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohex-3-en-1-one |
|---|---|
| PubChem CID | 91134295 |
| Molecular Formula | C35H34O5 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | (5R,6R)-4,5,6-tris(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohex-3-en-1-one |
| SMILES | O=C1CC(COCc2ccccc2)=C(OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H34O5/c36-32-21-31(26-37-22-27-13-5-1-6-14-27)33(38-23-28-15-7-2-8-16-28)35(40-25-30-19-11-4-12-20-30)34(32)39-24-29-17-9-3-10-18-29/h1-20,34-35H,21-26H2/t34-,35-/m0/s1 |
| InChIKey | YUTHUROAGVNCHR-PXLJZGITSA-N |
| XLogP | 6.82 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |