C29H34O8S — CID 71818197
[(1S,2S,3R,4S,5R,6R)-2,4-dihydroxy-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)cyclohexyl] methanesulfonate (PubChem CID 71818197) has the molecular formula C29H34O8S and a molecular weight of 542.65 g/mol. Its IUPAC name is [(1S,2S,3R,4S,5R,6R)-2,4-dihydroxy-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)cyclohexyl] methanesulfonate.
| Compound Name | [(1S,2S,3R,4S,5R,6R)-2,4-dihydroxy-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)cyclohexyl] methanesulfonate |
|---|---|
| PubChem CID | 71818197 |
| Molecular Formula | C29H34O8S |
| Molecular Weight | 542.65 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | [(1S,2S,3R,4S,5R,6R)-2,4-dihydroxy-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)cyclohexyl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H]1[C@@H](O)[C@H](OCc2ccccc2)[C@@H](O)[C@H](OCc2ccccc2)[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C29H34O8S/c1-38(32,33)37-28-24(20-34-17-21-11-5-2-6-12-21)27(35-18-22-13-7-3-8-14-22)25(30)29(26(28)31)36-19-23-15-9-4-10-16-23/h2-16,24-31H,17-20H2,1H3/t24-,25+,26-,27-,28+,29-/m1/s1 |
| InChIKey | MMYFLJCGNPUOEN-XBGOEWRMSA-N |
| XLogP | 3.07 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.65 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|