C27H30O4Si — CID 11155064
(3R,5S)-3-trimethylsilyloxy-5-(trityloxymethyl)oxolan-2-one (PubChem CID 11155064) has the molecular formula C27H30O4Si and a molecular weight of 446.62 g/mol. Its IUPAC name is (3R,5S)-3-trimethylsilyloxy-5-(trityloxymethyl)oxolan-2-one.
| Compound Name | (3R,5S)-3-trimethylsilyloxy-5-(trityloxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 11155064 |
| Molecular Formula | C27H30O4Si |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | (3R,5S)-3-trimethylsilyloxy-5-(trityloxymethyl)oxolan-2-one |
| SMILES | C[Si](C)(C)O[C@@H]1C[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)OC1=O |
| InChI | InChI=1S/C27H30O4Si/c1-32(2,3)31-25-19-24(30-26(25)28)20-29-27(21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23/h4-18,24-25H,19-20H2,1-3H3/t24-,25+/m0/s1 |
| InChIKey | OAPCNSWLBVITGA-LOSJGSFVSA-N |
| XLogP | 5.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|