C26H23IO3 — CID 102593831
(3Z,5S)-3-(1-iodoethylidene)-5-(trityloxymethyl)oxolan-2-one (PubChem CID 102593831) has the molecular formula C26H23IO3 and a molecular weight of 510.37 g/mol. Its IUPAC name is (3Z,5S)-3-(1-iodoethylidene)-5-(trityloxymethyl)oxolan-2-one.
| Compound Name | (3Z,5S)-3-(1-iodoethylidene)-5-(trityloxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 102593831 |
| Molecular Formula | C26H23IO3 |
| Molecular Weight | 510.37 g/mol |
| Exact Mass | 510.07 |
| IUPAC Name | (3Z,5S)-3-(1-iodoethylidene)-5-(trityloxymethyl)oxolan-2-one |
| SMILES | C/C(I)=C1\C[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)OC1=O |
| InChI | InChI=1S/C26H23IO3/c1-19(27)24-17-23(30-25(24)28)18-29-26(20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-16,23H,17-18H2,1H3/b24-19-/t23-/m0/s1 |
| InChIKey | ZIAKYASONSVWRH-PMKMQUDQSA-N |
| XLogP | 6.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.37 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|