C38H46O3Si — CID 25150053
tert-butyl-dimethyl-[(1S,2S,3R)-2-phenylmethoxy-3-(trityloxymethyl)cyclopentyl]oxysilane (PubChem CID 25150053) has the molecular formula C38H46O3Si and a molecular weight of 578.87 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1S,2S,3R)-2-phenylmethoxy-3-(trityloxymethyl)cyclopentyl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1S,2S,3R)-2-phenylmethoxy-3-(trityloxymethyl)cyclopentyl]oxysilane |
|---|---|
| PubChem CID | 25150053 |
| Molecular Formula | C38H46O3Si |
| Molecular Weight | 578.87 g/mol |
| Exact Mass | 578.32 |
| IUPAC Name | tert-butyl-dimethyl-[(1S,2S,3R)-2-phenylmethoxy-3-(trityloxymethyl)cyclopentyl]oxysilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C38H46O3Si/c1-37(2,3)42(4,5)41-35-27-26-31(36(35)39-28-30-18-10-6-11-19-30)29-40-38(32-20-12-7-13-21-32,33-22-14-8-15-23-33)34-24-16-9-17-25-34/h6-25,31,35-36H,26-29H2,1-5H3/t31-,35+,36+/m1/s1 |
| InChIKey | ZAPKVGIZVTXPAH-JNBVYXHXSA-N |
| XLogP | 9.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.87 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|