C40H35NO4 — CID 25149837
2-[(1R,2R,3R)-2-phenylmethoxy-3-(trityloxymethyl)cyclopentyl]isoindole-1,3-dione (PubChem CID 25149837) has the molecular formula C40H35NO4 and a molecular weight of 593.72 g/mol. Its IUPAC name is 2-[(1R,2R,3R)-2-phenylmethoxy-3-(trityloxymethyl)cyclopentyl]isoindole-1,3-dione.
| Compound Name | 2-[(1R,2R,3R)-2-phenylmethoxy-3-(trityloxymethyl)cyclopentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 25149837 |
| Molecular Formula | C40H35NO4 |
| Molecular Weight | 593.72 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | 2-[(1R,2R,3R)-2-phenylmethoxy-3-(trityloxymethyl)cyclopentyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1[C@@H]1CC[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C40H35NO4/c42-38-34-23-13-14-24-35(34)39(43)41(38)36-26-25-30(37(36)44-27-29-15-5-1-6-16-29)28-45-40(31-17-7-2-8-18-31,32-19-9-3-10-20-32)33-21-11-4-12-22-33/h1-24,30,36-37H,25-28H2/t30-,36-,37-/m1/s1 |
| InChIKey | WHHCLDKQBMYNRE-QPQSGNJTSA-N |
| XLogP | 7.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.72 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|