C32H29FO2 — CID 11784532
[[(1S,4S)-3-fluoro-4-phenylmethoxycyclopent-2-en-1-yl]methoxy-diphenylmethyl]benzene (PubChem CID 11784532) has the molecular formula C32H29FO2 and a molecular weight of 464.58 g/mol. Its IUPAC name is [[(1S,4S)-3-fluoro-4-phenylmethoxycyclopent-2-en-1-yl]methoxy-diphenylmethyl]benzene.
| Compound Name | [[(1S,4S)-3-fluoro-4-phenylmethoxycyclopent-2-en-1-yl]methoxy-diphenylmethyl]benzene |
|---|---|
| PubChem CID | 11784532 |
| Molecular Formula | C32H29FO2 |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | [[(1S,4S)-3-fluoro-4-phenylmethoxycyclopent-2-en-1-yl]methoxy-diphenylmethyl]benzene |
| SMILES | FC1=C[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C32H29FO2/c33-30-21-26(22-31(30)34-23-25-13-5-1-6-14-25)24-35-32(27-15-7-2-8-16-27,28-17-9-3-10-18-28)29-19-11-4-12-20-29/h1-21,26,31H,22-24H2/t26-,31+/m1/s1 |
| InChIKey | YGCUBVWIKMIDDV-NEEKEDPPSA-N |
| XLogP | 7.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|