C17H23NO2 — CID 102151512
(7S,8R,8aS)-7-ethyl-8-phenylmethoxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 102151512) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is (7S,8R,8aS)-7-ethyl-8-phenylmethoxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (7S,8R,8aS)-7-ethyl-8-phenylmethoxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 102151512 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | (7S,8R,8aS)-7-ethyl-8-phenylmethoxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | CC[C@H]1CCN2C(=O)CC[C@H]2[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C17H23NO2/c1-2-14-10-11-18-15(8-9-16(18)19)17(14)20-12-13-6-4-3-5-7-13/h3-7,14-15,17H,2,8-12H2,1H3/t14-,15-,17+/m0/s1 |
| InChIKey | RGLLLRJAMUPKFE-YQQAZPJKSA-N |
| XLogP | 2.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |