C23H28O3 — CID 90086841
(2R,3S,4R,5S)-5-ethyl-4-methyl-2,3-bis(phenylmethoxy)cyclohexan-1-one (PubChem CID 90086841) has the molecular formula C23H28O3 and a molecular weight of 352.47 g/mol. Its IUPAC name is (2R,3S,4R,5S)-5-ethyl-4-methyl-2,3-bis(phenylmethoxy)cyclohexan-1-one.
| Compound Name | (2R,3S,4R,5S)-5-ethyl-4-methyl-2,3-bis(phenylmethoxy)cyclohexan-1-one |
|---|---|
| PubChem CID | 90086841 |
| Molecular Formula | C23H28O3 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (2R,3S,4R,5S)-5-ethyl-4-methyl-2,3-bis(phenylmethoxy)cyclohexan-1-one |
| SMILES | CC[C@H]1CC(=O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C23H28O3/c1-3-20-14-21(24)23(26-16-19-12-8-5-9-13-19)22(17(20)2)25-15-18-10-6-4-7-11-18/h4-13,17,20,22-23H,3,14-16H2,1-2H3/t17-,20+,22+,23+/m1/s1 |
| InChIKey | VHVGBJGXYJUFEQ-BHVFFLMSSA-N |
| XLogP | 4.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |