C19H27NO4 — CID 102308622
(5S,6R,7R)-7-(diethoxymethyl)-5-phenylmethoxy-1-azabicyclo[4.2.0]octan-8-one (PubChem CID 102308622) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is (5S,6R,7R)-7-(diethoxymethyl)-5-phenylmethoxy-1-azabicyclo[4.2.0]octan-8-one.
| Compound Name | (5S,6R,7R)-7-(diethoxymethyl)-5-phenylmethoxy-1-azabicyclo[4.2.0]octan-8-one |
|---|---|
| PubChem CID | 102308622 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (5S,6R,7R)-7-(diethoxymethyl)-5-phenylmethoxy-1-azabicyclo[4.2.0]octan-8-one |
| SMILES | CCOC(OCC)[C@@H]1C(=O)N2CCC[C@H](OCc3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C19H27NO4/c1-3-22-19(23-4-2)16-17-15(11-8-12-20(17)18(16)21)24-13-14-9-6-5-7-10-14/h5-7,9-10,15-17,19H,3-4,8,11-13H2,1-2H3/t15-,16-,17-/m0/s1 |
| InChIKey | XUKTWBGEFQIAEB-ULQDDVLXSA-N |
| XLogP | 2.59 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|