C37H38N2O5 — CID 25149944
(E)-3-methoxy-N-[[(1R,2R,3R)-2-phenylmethoxy-3-(trityloxymethyl)cyclopentyl]carbamoyl]prop-2-enamide (PubChem CID 25149944) has the molecular formula C37H38N2O5 and a molecular weight of 590.72 g/mol. Its IUPAC name is (E)-3-methoxy-N-[[(1R,2R,3R)-2-phenylmethoxy-3-(trityloxymethyl)cyclopentyl]carbamoyl]prop-2-enamide.
| Compound Name | (E)-3-methoxy-N-[[(1R,2R,3R)-2-phenylmethoxy-3-(trityloxymethyl)cyclopentyl]carbamoyl]prop-2-enamide |
|---|---|
| PubChem CID | 25149944 |
| Molecular Formula | C37H38N2O5 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.28 |
| IUPAC Name | (E)-3-methoxy-N-[[(1R,2R,3R)-2-phenylmethoxy-3-(trityloxymethyl)cyclopentyl]carbamoyl]prop-2-enamide |
| SMILES | CO/C=C/C(=O)NC(=O)N[C@@H]1CC[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C37H38N2O5/c1-42-25-24-34(40)39-36(41)38-33-23-22-29(35(33)43-26-28-14-6-2-7-15-28)27-44-37(30-16-8-3-9-17-30,31-18-10-4-11-19-31)32-20-12-5-13-21-32/h2-21,24-25,29,33,35H,22-23,26-27H2,1H3,(H2,38,39,40,41)/b25-24+/t29-,33-,35-/m1/s1 |
| InChIKey | JPZKRIWZVGLNDK-ISRDRFJMSA-N |
| XLogP | 6.34 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|