C41H41N4O5+ — CID 6333394
[5-acetamido-4,6-bis(phenylmethoxy)-2-(trityloxymethyl)oxan-3-yl]imino-iminoazanium (PubChem CID 6333394) has the molecular formula C41H41N4O5+ and a molecular weight of 669.80 g/mol. Its IUPAC name is [5-acetamido-4,6-bis(phenylmethoxy)-2-(trityloxymethyl)oxan-3-yl]imino-iminoazanium.
| Compound Name | [5-acetamido-4,6-bis(phenylmethoxy)-2-(trityloxymethyl)oxan-3-yl]imino-iminoazanium |
|---|---|
| PubChem CID | 6333394 |
| Molecular Formula | C41H41N4O5+ |
| Molecular Weight | 669.80 g/mol |
| Exact Mass | 669.31 |
| IUPAC Name | [5-acetamido-4,6-bis(phenylmethoxy)-2-(trityloxymethyl)oxan-3-yl]imino-iminoazanium |
| SMILES | CC(=O)NC1C(OCc2ccccc2)OC(COC(c2ccccc2)(c2ccccc2)c2ccccc2)C(N=[N+]=N)C1OCc1ccccc1 |
| InChI | InChI=1S/C41H40N4O5/c1-30(46)43-38-39(47-27-31-17-7-2-8-18-31)37(44-45-42)36(50-40(38)48-28-32-19-9-3-10-20-32)29-49-41(33-21-11-4-12-22-33,34-23-13-5-14-24-34)35-25-15-6-16-26-35/h2-26,36-40,42H,27-29H2,1H3/p+1 |
| InChIKey | VNSPWOLZQGWHSG-UHFFFAOYSA-O |
| XLogP | 6.95 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.80 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|