C15H24Cl2O3Si — CID 172628478
1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,4-dichloro-5-methyl-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 172628478) has the molecular formula C15H24Cl2O3Si and a molecular weight of 351.35 g/mol. Its IUPAC name is 1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,4-dichloro-5-methyl-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | 1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,4-dichloro-5-methyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 172628478 |
| Molecular Formula | C15H24Cl2O3Si |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,4-dichloro-5-methyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | CC12C=CC(CO[Si](C)(C)C(C)(C)C)(O1)C(Cl)C(=O)C2Cl |
| InChI | InChI=1S/C15H24Cl2O3Si/c1-13(2,3)21(5,6)19-9-15-8-7-14(4,20-15)11(16)10(18)12(15)17/h7-8,11-12H,9H2,1-6H3 |
| InChIKey | JCQFNMIFUGYDSQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|