C22H46O4Si2 — CID 91549548
ethyl (4R,5S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylhept-2-enoate (PubChem CID 91549548) has the molecular formula C22H46O4Si2 and a molecular weight of 430.78 g/mol. Its IUPAC name is ethyl (4R,5S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylhept-2-enoate.
| Compound Name | ethyl (4R,5S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylhept-2-enoate |
|---|---|
| PubChem CID | 91549548 |
| Molecular Formula | C22H46O4Si2 |
| Molecular Weight | 430.78 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | ethyl (4R,5S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylhept-2-enoate |
| SMILES | CCOC(=O)C=C[C@@H](C)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H46O4Si2/c1-13-24-20(23)15-14-18(2)19(26-28(11,12)22(6,7)8)16-17-25-27(9,10)21(3,4)5/h14-15,18-19H,13,16-17H2,1-12H3/t18-,19+/m1/s1 |
| InChIKey | VITHGYBTVNARLC-MOPGFXCFSA-N |
| XLogP | 6.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.78 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|