C26H45IO5Si2 — CID 101217865
(2R)-2-[(1E,3R,4R,7Z)-8-iodo-3-methyl-6-oxo-3,4-bis(triethylsilyloxy)octa-1,7-dienyl]-2,3-dihydropyran-6-one (PubChem CID 101217865) has the molecular formula C26H45IO5Si2 and a molecular weight of 620.72 g/mol. Its IUPAC name is (2R)-2-[(1E,3R,4R,7Z)-8-iodo-3-methyl-6-oxo-3,4-bis(triethylsilyloxy)octa-1,7-dienyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(1E,3R,4R,7Z)-8-iodo-3-methyl-6-oxo-3,4-bis(triethylsilyloxy)octa-1,7-dienyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 101217865 |
| Molecular Formula | C26H45IO5Si2 |
| Molecular Weight | 620.72 g/mol |
| Exact Mass | 620.19 |
| IUPAC Name | (2R)-2-[(1E,3R,4R,7Z)-8-iodo-3-methyl-6-oxo-3,4-bis(triethylsilyloxy)octa-1,7-dienyl]-2,3-dihydropyran-6-one |
| SMILES | CC[Si](CC)(CC)O[C@H](CC(=O)/C=C\I)[C@@](C)(/C=C/[C@H]1CC=CC(=O)O1)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C26H45IO5Si2/c1-8-33(9-2,10-3)31-24(21-22(28)18-20-27)26(7,32-34(11-4,12-5)13-6)19-17-23-15-14-16-25(29)30-23/h14,16-20,23-24H,8-13,15,21H2,1-7H3/b19-17+,20-18-/t23-,24-,26-/m1/s1 |
| InChIKey | NEISZNYOOJPMCV-ISQAKDIPSA-N |
| XLogP | 7.49 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.72 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|