C21H36O4Si — CID 91241902
ethyl (8S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethyl-11-oxoundeca-2,4,6-trienoate (PubChem CID 91241902) has the molecular formula C21H36O4Si and a molecular weight of 380.60 g/mol. Its IUPAC name is ethyl (8S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethyl-11-oxoundeca-2,4,6-trienoate.
| Compound Name | ethyl (8S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethyl-11-oxoundeca-2,4,6-trienoate |
|---|---|
| PubChem CID | 91241902 |
| Molecular Formula | C21H36O4Si |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | ethyl (8S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethyl-11-oxoundeca-2,4,6-trienoate |
| SMILES | CCOC(=O)C=CC=CC(C)=C[C@H](C)[C@H](CC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36O4Si/c1-9-24-20(23)13-11-10-12-17(2)16-18(3)19(14-15-22)25-26(7,8)21(4,5)6/h10-13,15-16,18-19H,9,14H2,1-8H3/t18-,19-/m0/s1 |
| InChIKey | CTRADFYUFXSPEB-OALUTQOASA-N |
| XLogP | 5.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|