C28H46F10O5Si2 — CID 162538169
methyl (E,4R,5S)-7-oxo-4,5-bis[[3,3,4,4,4-pentafluorobutyl-di(propan-2-yl)silyl]oxy]hept-2-enoate (PubChem CID 162538169) has the molecular formula C28H46F10O5Si2 and a molecular weight of 708.82 g/mol. Its IUPAC name is methyl (E,4R,5S)-7-oxo-4,5-bis[[3,3,4,4,4-pentafluorobutyl-di(propan-2-yl)silyl]oxy]hept-2-enoate.
| Compound Name | methyl (E,4R,5S)-7-oxo-4,5-bis[[3,3,4,4,4-pentafluorobutyl-di(propan-2-yl)silyl]oxy]hept-2-enoate |
|---|---|
| PubChem CID | 162538169 |
| Molecular Formula | C28H46F10O5Si2 |
| Molecular Weight | 708.82 g/mol |
| Exact Mass | 708.27 |
| IUPAC Name | methyl (E,4R,5S)-7-oxo-4,5-bis[[3,3,4,4,4-pentafluorobutyl-di(propan-2-yl)silyl]oxy]hept-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H](O[Si](CCC(F)(F)C(F)(F)F)(C(C)C)C(C)C)[C@H](CC=O)O[Si](CCC(F)(F)C(F)(F)F)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H46F10O5Si2/c1-18(2)44(19(3)4,16-13-25(29,30)27(33,34)35)42-22(10-11-24(40)41-9)23(12-15-39)43-45(20(5)6,21(7)8)17-14-26(31,32)28(36,37)38/h10-11,15,18-23H,12-14,16-17H2,1-9H3/b11-10+/t22-,23+/m1/s1 |
| InChIKey | GYWTUMKSJJHRAV-AAPCUUHVSA-N |
| XLogP | 9.78 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.82 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|