C19H36O5Si — CID 15259247
dipropan-2-yl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-prop-2-enylbutanedioate (PubChem CID 15259247) has the molecular formula C19H36O5Si and a molecular weight of 372.58 g/mol. Its IUPAC name is dipropan-2-yl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-prop-2-enylbutanedioate.
| Compound Name | dipropan-2-yl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-prop-2-enylbutanedioate |
|---|---|
| PubChem CID | 15259247 |
| Molecular Formula | C19H36O5Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | dipropan-2-yl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-prop-2-enylbutanedioate |
| SMILES | C=CC[C@@H](C(=O)OC(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)OC(C)C |
| InChI | InChI=1S/C19H36O5Si/c1-11-12-15(17(20)22-13(2)3)16(18(21)23-14(4)5)24-25(9,10)19(6,7)8/h11,13-16H,1,12H2,2-10H3/t15-,16-/m1/s1 |
| InChIKey | XVWVSIRJDYGZJJ-HZPDHXFCSA-N |
| XLogP | 4.47 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|