C14H26O5Si — CID 14934286
diethyl (2R,3R)-2-prop-2-enyl-3-trimethylsilyloxybutanedioate (PubChem CID 14934286) has the molecular formula C14H26O5Si and a molecular weight of 302.44 g/mol. Its IUPAC name is diethyl (2R,3R)-2-prop-2-enyl-3-trimethylsilyloxybutanedioate.
| Compound Name | diethyl (2R,3R)-2-prop-2-enyl-3-trimethylsilyloxybutanedioate |
|---|---|
| PubChem CID | 14934286 |
| Molecular Formula | C14H26O5Si |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | diethyl (2R,3R)-2-prop-2-enyl-3-trimethylsilyloxybutanedioate |
| SMILES | C=CC[C@@H](C(=O)OCC)[C@@H](O[Si](C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C14H26O5Si/c1-7-10-11(13(15)17-8-2)12(14(16)18-9-3)19-20(4,5)6/h7,11-12H,1,8-10H2,2-6H3/t11-,12-/m1/s1 |
| InChIKey | GSKOKZGKSVXQIJ-VXGBXAGGSA-N |
| XLogP | 2.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|