C9H12Li2O5 — CID 59875798
dilithium;(3R)-2-ethoxy-3-prop-2-enylbutanedioate (PubChem CID 59875798) has the molecular formula C9H12Li2O5 and a molecular weight of 214.07 g/mol. Its IUPAC name is dilithium;(3R)-2-ethoxy-3-prop-2-enylbutanedioate.
| Compound Name | dilithium;(3R)-2-ethoxy-3-prop-2-enylbutanedioate |
|---|---|
| PubChem CID | 59875798 |
| Molecular Formula | C9H12Li2O5 |
| Molecular Weight | 214.07 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | dilithium;(3R)-2-ethoxy-3-prop-2-enylbutanedioate |
| SMILES | C=CC[C@@H](C(=O)[O-])C(OCC)C(=O)[O-].[Li+].[Li+] |
| InChI | InChI=1S/C9H14O5.2Li/c1-3-5-6(8(10)11)7(9(12)13)14-4-2;;/h3,6-7H,1,4-5H2,2H3,(H,10,11)(H,12,13);;/q;2*+1/p-2/t6-,7?;;/m1../s1 |
| InChIKey | HOOMLPBJZPOGLK-DKPBNVODSA-L |
| XLogP | -7.91 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.07 |
| LogP ≤ 5 | -7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|