C15H26O5 — CID 57160954
dipropan-2-yl (2S,3R)-2-ethoxy-3-prop-2-enylbutanedioate (PubChem CID 57160954) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is dipropan-2-yl (2S,3R)-2-ethoxy-3-prop-2-enylbutanedioate.
| Compound Name | dipropan-2-yl (2S,3R)-2-ethoxy-3-prop-2-enylbutanedioate |
|---|---|
| PubChem CID | 57160954 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | dipropan-2-yl (2S,3R)-2-ethoxy-3-prop-2-enylbutanedioate |
| SMILES | C=CC[C@@H](C(=O)OC(C)C)[C@H](OCC)C(=O)OC(C)C |
| InChI | InChI=1S/C15H26O5/c1-7-9-12(14(16)19-10(3)4)13(18-8-2)15(17)20-11(5)6/h7,10-13H,1,8-9H2,2-6H3/t12-,13+/m1/s1 |
| InChIKey | HYGRRFHVOXRFDO-OLZOCXBDSA-N |
| XLogP | 2.49 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|