C20H40O4Si2 — CID 11143852
(3S,4R,5S)-5-but-3-enyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-one (PubChem CID 11143852) has the molecular formula C20H40O4Si2 and a molecular weight of 400.71 g/mol. Its IUPAC name is (3S,4R,5S)-5-but-3-enyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-one.
| Compound Name | (3S,4R,5S)-5-but-3-enyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-one |
|---|---|
| PubChem CID | 11143852 |
| Molecular Formula | C20H40O4Si2 |
| Molecular Weight | 400.71 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | (3S,4R,5S)-5-but-3-enyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-one |
| SMILES | C=CCC[C@@H]1OC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O4Si2/c1-12-13-14-15-16(23-25(8,9)19(2,3)4)17(18(21)22-15)24-26(10,11)20(5,6)7/h12,15-17H,1,13-14H2,2-11H3/t15-,16+,17-/m0/s1 |
| InChIKey | AOGSJZGGHIEADA-BBWFWOEESA-N |
| XLogP | 5.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.71 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|