C18H36O4Si — CID 11645898
tert-butyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyoct-7-enoate (PubChem CID 11645898) has the molecular formula C18H36O4Si and a molecular weight of 344.57 g/mol. Its IUPAC name is tert-butyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyoct-7-enoate.
| Compound Name | tert-butyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyoct-7-enoate |
|---|---|
| PubChem CID | 11645898 |
| Molecular Formula | C18H36O4Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | tert-butyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxyoct-7-enoate |
| SMILES | C=CCCC[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H36O4Si/c1-10-11-12-13-14(19)15(16(20)21-17(2,3)4)22-23(8,9)18(5,6)7/h10,14-15,19H,1,11-13H2,2-9H3/t14-,15-/m1/s1 |
| InChIKey | HFQGKPDHZLBCRN-HUUCEWRRSA-N |
| XLogP | 4.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|