C24H46O4Si — CID 91369822
(3-hydroxy-2-trimethylsilyloxypropyl) octadeca-9,12-dienoate (PubChem CID 91369822) has the molecular formula C24H46O4Si and a molecular weight of 426.71 g/mol. Its IUPAC name is (3-hydroxy-2-trimethylsilyloxypropyl) octadeca-9,12-dienoate.
| Compound Name | (3-hydroxy-2-trimethylsilyloxypropyl) octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 91369822 |
| Molecular Formula | C24H46O4Si |
| Molecular Weight | 426.71 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | (3-hydroxy-2-trimethylsilyloxypropyl) octadeca-9,12-dienoate |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)OCC(CO)O[Si](C)(C)C |
| InChI | InChI=1S/C24H46O4Si/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24(26)27-22-23(21-25)28-29(2,3)4/h9-10,12-13,23,25H,5-8,11,14-22H2,1-4H3 |
| InChIKey | UMZKXSVTCVSMGD-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.71 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|