C22H42O4Si — CID 11611003
1-[(4S,5S)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxypentyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hex-5-en-1-one (PubChem CID 11611003) has the molecular formula C22H42O4Si and a molecular weight of 398.66 g/mol. Its IUPAC name is 1-[(4S,5S)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxypentyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hex-5-en-1-one.
| Compound Name | 1-[(4S,5S)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxypentyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hex-5-en-1-one |
|---|---|
| PubChem CID | 11611003 |
| Molecular Formula | C22H42O4Si |
| Molecular Weight | 398.66 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | 1-[(4S,5S)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxypentyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hex-5-en-1-one |
| SMILES | C=CCCCC(=O)[C@H]1OC(C)(C)O[C@@H]1[C@H](CCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H42O4Si/c1-10-12-14-15-17(23)19-20(25-22(6,7)24-19)18(16-13-11-2)26-27(8,9)21(3,4)5/h10,18-20H,1,11-16H2,2-9H3/t18-,19+,20+/m0/s1 |
| InChIKey | CGCVIAJWVIWHHQ-XUVXKRRUSA-N |
| XLogP | 6.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.66 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|