C20H36O4Si — CID 10893938
methyl 2,2-dimethyl-5-[(3E)-3-methyl-7-(trimethylsilylmethyl)octa-3,7-dienyl]-1,3-dioxolane-4-carboxylate (PubChem CID 10893938) has the molecular formula C20H36O4Si and a molecular weight of 368.59 g/mol. Its IUPAC name is methyl 2,2-dimethyl-5-[(3E)-3-methyl-7-(trimethylsilylmethyl)octa-3,7-dienyl]-1,3-dioxolane-4-carboxylate.
| Compound Name | methyl 2,2-dimethyl-5-[(3E)-3-methyl-7-(trimethylsilylmethyl)octa-3,7-dienyl]-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 10893938 |
| Molecular Formula | C20H36O4Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | methyl 2,2-dimethyl-5-[(3E)-3-methyl-7-(trimethylsilylmethyl)octa-3,7-dienyl]-1,3-dioxolane-4-carboxylate |
| SMILES | C=C(CC/C=C(\C)CCC1OC(C)(C)OC1C(=O)OC)C[Si](C)(C)C |
| InChI | InChI=1S/C20H36O4Si/c1-15(10-9-11-16(2)14-25(6,7)8)12-13-17-18(19(21)22-5)24-20(3,4)23-17/h10,17-18H,2,9,11-14H2,1,3-8H3/b15-10+ |
| InChIKey | FTFOXYKXHFZMMS-XNTDXEJSSA-N |
| XLogP | 5.08 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|