C26H50O6Si — CID 71816859
methyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4S,5R)-5-[(E,11S)-11-hydroxydodec-5-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetate (PubChem CID 71816859) has the molecular formula C26H50O6Si and a molecular weight of 486.77 g/mol. Its IUPAC name is methyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4S,5R)-5-[(E,11S)-11-hydroxydodec-5-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetate.
| Compound Name | methyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4S,5R)-5-[(E,11S)-11-hydroxydodec-5-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetate |
|---|---|
| PubChem CID | 71816859 |
| Molecular Formula | C26H50O6Si |
| Molecular Weight | 486.77 g/mol |
| Exact Mass | 486.34 |
| IUPAC Name | methyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4S,5R)-5-[(E,11S)-11-hydroxydodec-5-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetate |
| SMILES | COC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@@H]1CCCC/C=C/CCCC[C@H](C)O |
| InChI | InChI=1S/C26H50O6Si/c1-20(27)18-16-14-12-10-11-13-15-17-19-21-22(31-26(5,6)30-21)23(24(28)29-7)32-33(8,9)25(2,3)4/h10-11,20-23,27H,12-19H2,1-9H3/b11-10+/t20-,21+,22-,23-/m0/s1 |
| InChIKey | QZGRVGLKUMMQBO-HWYROZLCSA-N |
| XLogP | 6.13 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.77 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|